On Target 5HT1F_HUMAN 0.28395063/CHEMBL102292
For the given ligand D9-1, we have found in our database that, being scored 0.28395063, the most similar ligand is CHEMBL102292. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL102292 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCNC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000006 01800a00 00184180 40810e10 000c1240 00000000 0000a004 20002001 00400a00 000800c0 08380024 5011a000 08008802 00500800 00040840 00140004 08040000 02404008 08600400 00a00205 40000100 5c018408 21822840 80700018 00142000 80000100 08008080 10000084 00008018 0006180b 00040200 00004720 |