On Target NPBW1_HUMAN 0.19617225/CHEMBL1705499
For the given ligand D9-1, we have found in our database that, being scored 0.19617225, the most similar ligand is CHEMBL1705499. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL1705499 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | COc1ccc(OC2=C(Cl)C=NN(C2=O)c3cccc4CCCCc34)cc1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0001000e 01000608 6010010a 10010600 04081038 0000c008 43040002 01001001 06500900 800908c0 29102004 78858800 0600880a 02b00800 01020041 030d200c 00040200 0200002c 00202518 40260001 40420580 1c018328 20804880 83700110 04141000 80008a01 08080000 10200000 04400202 00c6000a c0040400 a2e60680 |