On Target CLTR1_HUMAN 0.22395833/CHEMBL143515
For the given ligand D9-1, we have found in our database that, being scored 0.22395833, the most similar ligand is CHEMBL143515. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL143515 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC(C)(O)c1ccccc1CC[C@@H](SCC2(CC(=O)O)CC2)c3cccc(\C=C\c4ccc5CCCc5n4)c3 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0001000a 01004480 0000650a 10910e10 000c1021 06006002 a1002090 08000409 84400900 08084850 08108104 40889800 04019800 41241800 80020022 020e000c 04008408 06000104 00600408 00000001 65000500 18908a20 21804300 00410010 00040000 82000201 18402048 40001280 80404004 00a60032 44000080 21010400 |