On Target ACM3_HUMAN 0.28767124/CHEMBL207287
For the given ligand D9-1, we have found in our database that, being scored 0.28767124, the most similar ligand is CHEMBL207287. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL207287 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | C1CCCN(CC1)c2nc(nc3NCCCc23)C4CC4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0001000a 01000000 00100000 18880610 21000220 00006040 0200b800 20100800 10400900 000c0090 2020a004 40811000 04000082 01000800 00020000 000c0006 00049000 06004000 00402008 c0200201 04100000 10442010 24804040 00100010 000c0000 01100000 00000400 10001080 0008000c 00c60008 40001080 200022c0 |