On Target DRD3_HUMAN 0.31578946/CHEMBL105977
For the given ligand D9-1, we have found in our database that, being scored 0.31578946, the most similar ligand is CHEMBL105977. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL105977 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCCN(CCC)C1CCc2ncccc2C1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000000a 01004200 00104102 11800610 00041120 00000000 01002020 20000001 00400880 000900c0 08308004 40800000 00000802 00200800 00020000 02040004 00000200 06000004 00202408 00000201 60100100 18208000 20804000 91400010 00040000 80000001 08000040 10000180 04400006 0086000a 00000000 20002600 |