On Target 5HT1E_HUMAN 0.25/CHEMBL105261
For the given ligand D9-1, we have found in our database that, being scored 0.25, the most similar ligand is CHEMBL105261. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL105261 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCC(=O)Nc1ccc2[nH]cc(C3CCN(C)CC3)c2n1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00004002 01800a00 00184180 40810610 200c1240 00000000 0000a000 20100000 00400800 200800c0 08380004 5001b000 08008802 00500800 00060840 00040004 08040000 02004008 08600400 00a00205 40100100 5c008608 21802840 80700010 00042000 80000000 08008080 10000084 00008008 0006180b 00041200 00000720 |