On Target 5HT2A_HUMAN 0.30921054/CHEMBL559251
For the given ligand D9-1, we have found in our database that, being scored 0.30921054, the most similar ligand is CHEMBL559251. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL559251 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN(C)CCC1=C(Cc2cnccn2)c3ccccc3C1 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0208000a 09000000 04100703 10810610 02000040 00800002 8008a081 00000403 10500800 00b809c0 08b08000 41018000 00004000 00200a40 00820022 00048004 08000400 06100040 00200408 00000801 00100100 18108000 2140c000 08500010 01040800 80000009 08402000 50000004 00400004 00860c02 04000000 20000740 |