On Target AA2AR_HUMAN 0.29655173/CHEMBL3093327
For the given ligand D9-1, we have found in our database that, being scored 0.29655173, the most similar ligand is CHEMBL3093327. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL3093327 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN1C(=O)N(C)c2nc([nH]c2C1=O)[C@@]34C[C@@H]5C[C@H](C[C@H]3C5)C4 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000002a 01801800 00180400 12010600 04080060 0000c400 01009000 00000400 16400100 800010a0 0c00800c 40800800 00009000 00500000 002a0080 080c000c 00800000 04008000 02402008 00000001 80100500 10000040 21800041 00300014 00040000 c0200200 60000000 10041080 00004005 01c60800 c0020000 60000280 |