On Target CXCR1_HUMAN 0.18025751/CHEMBL401893
For the given ligand D9-1, we have found in our database that, being scored 0.18025751, the most similar ligand is CHEMBL401893. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL401893 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCC(NC1=C(Nc2cccc(C(=O)N(C)C)c2O)C(=O)C1=O)c3nccs3 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 1043400a 00000808 62100102 10012e00 26008001 68122000 020000a0 2241f50b 05a00440 005008d0 00298a04 d002b000 0a0088d2 00200020 81826040 1004614c 00051001 26008086 08230218 20020201 48101880 d8138680 20000000 00418014 06141000 8c000080 20400010 900c05c4 20508306 20861001 8c045420 60012210 |