On Target DRD1_HUMAN 0.2967033/CHEMBL3697602
For the given ligand D9-1, we have found in our database that, being scored 0.2967033, the most similar ligand is CHEMBL3697602. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL3697602 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN1C(=O)C=NC(=C1c2ccc(Oc3ncccc3C4CC4)cc2C)C |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00004022 40004019 20104108 10818610 80041040 04000108 0604ec05 00480200 16400804 10081870 08108004 40008040 01008832 01200800 21820101 8014200c 18020020 82002004 04682400 00620201 c5520180 38008000 21801000 00600410 00040003 c0080000 08020200 10200054 0040c3a4 00060802 000a0c00 04000600 |