On Target DRD5_HUMAN 0.26027396/CHEMBL216439
For the given ligand D9-1, we have found in our database that, being scored 0.26027396, the most similar ligand is CHEMBL216439. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL216439 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CN1CCCc2c(Cc3ccccc3CC1)[nH]c4ccccc24 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 0000000a 00004a00 00100100 50810610 00041220 00080002 00002400 21001001 04400880 000808c0 08308004 40808000 08000802 00608800 00020040 02040084 00000200 02000005 00300400 00000201 40000100 18208008 20804000 81400010 00042000 a0000001 08000000 50000000 06000084 0006000a 00040200 20012620 |