On Target NPFF1_HUMAN 0.27011493/CHEMBL388586
For the given ligand D9-1, we have found in our database that, being scored 0.27011493, the most similar ligand is CHEMBL388586. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL388586 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CC(C)C[C@H](NC(=O)CNC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(F)cc2)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00018002 01003a00 00100100 47810e10 00041200 00000010 00002000 2200300c 00600a80 000908c2 08300004 4003b000 1e009812 00403801 80200440 00140004 00000000 02000100 00200408 00100201 40000100 38278628 20800003 9350001c 00043800 c0000000 48000000 90000001 0c000110 0006800b a00c4200 00002620 |