On Target OPRX_HUMAN 0.2948718/CHEMBL3647961
For the given ligand D9-1, we have found in our database that, being scored 0.2948718, the most similar ligand is CHEMBL3647961. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL3647961 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | OC(=O)C1=Nc2ccccc2N([C@H]3C[C@H]4CCC[C@@H](C3)N4C56CCCC(CCC5)C6)C1=O |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000022 01809c00 00100000 10000610 000c1062 000080c0 00008006 20000000 16200300 800019e0 0c280004 50018000 00008802 00d40000 009600c0 020c000c 08108000 82800000 02602000 00000201 c0000080 18048a50 21806006 0030001c 00040000 40000000 08008000 10000004 00000004 00060811 c00e0000 00002200 |