On Target ACM2_HUMAN 0.27272728/CHEMBL4097258
For the given ligand D9-1, we have found in our database that, being scored 0.27272728, the most similar ligand is CHEMBL4097258. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL4097258 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCC(=O)NCc1cc(cc(c1)C(=O)NCCNC(=O)CCc2cn(CCCCC3CCN(CC(=O)N4c5ccccc5NC(=O)c6ccccc46)CC3)cn2)C(=O)NCCNC(=O)CCc7cn(CCCCC8CCN(CC(=O)N9c%10ccccc%10NC(=O)c%11ccccc9%11)CC8)cn7.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 02000022 01802c00 00100180 44810718 040c0241 00000460 1080a020 22001008 06600900 c0090ce0 2c20800c 5001b800 06009802 01f02800 80360cc0 080c000c 08030000 86004000 00602818 40000205 e0000400 38028e18 21800041 8250001c 08041000 c0000200 08008000 90040100 08000105 0046001b e00e4000 20000208 |