On Target 5HT4R_HUMAN 0.27380952/CHEMBL401607
For the given ligand D9-1, we have found in our database that, being scored 0.27380952, the most similar ligand is CHEMBL401607. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL401607 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | NC(=N)NCCC[C@@H]1NC(=O)C(Cc2c[nH]c3cc(Br)ccc23)NC1=O |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00014002 0100ba00 00100100 45810e10 00041200 00000000 00002000 2000200c 00600a80 010908c2 08300004 c003b000 1e009812 00402801 80000040 00140004 00000000 02000000 00200408 00000201 40000100 38258628 20800021 93500018 00043800 80000000 48060000 10000000 0c000010 000e000b a00c4208 09002620 |