On Target 5HT1A_HUMAN 0.29299363/CHEMBL275572
For the given ligand D9-1, we have found in our database that, being scored 0.29299363, the most similar ligand is CHEMBL275572. Check out the elaboration below.
| D9-1 (Given Ligand) | CHEMBL275572 (Similar Ligand) |
|---|---|
| CC(C)Cc1ncc(CCCNC(=N)N)[nH]c1=O | CCCN(CCC)C1CN2C(=O)C=Nc3cccc(C1)c23 |
|
|
|
|
|
|
| 0000002a 00002000 00100400 10800c10 00000242 00000000 0000a824 00002008 16400a00 000800b2 08208000 40000000 00009080 02000800 00820000 00140004 08000000 06000000 00000408 00000001 24020080 10018000 21000000 00200010 00040000 40000000 48000000 10000104 00000014 00860808 80280000 20000200 | 00000022 00000e00 00101100 41810610 000c0040 00000140 0000a006 00000000 06700881 800908e0 0c300004 40018000 98008802 01c00800 009408c0 00040004 08000000 82000000 00600400 00000201 c0000180 38208010 21800001 93600414 0c042000 c0000000 08008040 10000004 8c000000 0006001a 000c0000 00002620 |