On Target CCR5_HUMAN 0/CHEMBL140552
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL140552. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL140552 (Similar Ligand) |
|---|---|
| C | CCO\N=C(/C1CCN(CC1)C2(C)CCN(CC2)C(=O)c3c(C)nc(nc3C)C(F)(F)F)\c4ccc(Br)cc4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 10004002 01009c00 01100102 10050e10 00000020 1000c000 10005040 20005002 00108948 000809f1 4c310004 50018800 00008812 00308000 00920480 000d001c 00020000 02000400 00404400 40800601 80020100 180c8e00 20800040 00500518 00040000 c1000004 48124000 92001010 0000000c 00460013 e0080008 880026a0 |