On Target NK2R_HUMAN 0/CHEMBL105295
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL105295. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL105295 (Similar Ligand) |
|---|---|
| C | CN(N(CCC(=O)N[C@@H]1CCCCNC1=O)Cc2cc(Br)c(Br)s2)C(=O)c3cc(cc(c3)C(F)(F)F)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 01014004 290abc00 02140100 04010600 00680001 04010000 10000480 2200500a 42000000 400009f8 00300208 6001b082 0e20c81a 09202020 a0002700 0800000c 81003000 0200080c 042020b0 80000609 40001000 780686b0 40004001 0250001c 32001080 c4000004 08120000 90000004 09000308 004e8013 a0144028 08c53280 |