On Target ADRB3_HUMAN 0/CHEMBL400067
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL400067. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL400067 (Similar Ligand) |
|---|---|
| C | COc1ccc(cc1OC)[C@H](CCc2ccccc2)NC[C@H](O)Cc3ccc(O)c(NS(=O)(=O)C)c3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000000a 47000208 2010010a 00310600 000010c0 40000000 02040000 22001000 00400800 000808c0 08302004 40008000 00004c02 20200801 810c1441 000ec028 18080000 0a000000 00080000 00024201 40000100 18008800 23000000 00448010 00040080 c0000000 00320000 9000000c 00400302 0006000a 20040000 00012660 |