On Target ACM4_HUMAN 0/CHEMBL58228
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL58228. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL58228 (Similar Ligand) |
|---|---|
| C | CCOC(=O)c1c(C)[nH]c2ccc3OC4N(CCc5cc(OC)c(OC)cc45)Cc3c12 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0400000a 4e809808 60100109 90010610 00041030 8000c500 161c0000 22021404 14400380 00180c48 48200004 40008800 8080c886 2061a000 01020445 0a1ea00c 00022209 02088024 00290002 40020200 c0020840 18228a38 20804000 81c4b01c 00046400 c0012222 087a4040 80000000 04400305 0006000a e4048204 00000620 |