On Target ADA1D_HUMAN 0/CHEMBL357131
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL357131. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL357131 (Similar Ligand) |
|---|---|
| C | COC(=O)C1=C(C)N=C(C)N(CCC[C@H](C)CN2CCC(CC2)(C(=O)OC)c3ccccc3)C1c4ccc(F)c(F)c4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00420040 01048218 00304100 02210700 00140050 00a00010 10100001 22011440 01000a80 009828d3 5a300010 50019000 0d40ac42 08011008 40040420 001c0018 28221800 02100380 04c30018 00100a09 00002100 3a00aa20 010080d1 00504190 00023cc1 cc000001 c0480200 90040001 02100310 0006860a a4042000 c2802e10 |