On Target 5HT5A_HUMAN 0/CHEMBL442
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL442. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL442 (Similar Ligand) |
|---|---|
| C | CN1C[C@@H](C=C2[C@H]1Cc3c[nH]c4cccc2c34)C(=O)N[C@]5(C)O[C@@]6(O)[C@@H]7CCCN7C(=O)[C@H](Cc8ccccc8)N6C5=O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 02000012 29d0fe00 01900302 c5910710 000c1180 00038010 800a30c0 a000040e 00c00ac0 001909ea 08302004 4101f000 be02890e 01612b03 8018104a 183e120c 30800440 82080144 00660d1a 00000201 40000520 3a2486b8 33808023 9350003c 31243c00 80081002 18c82048 f0200021 0c404200 00260c1b a4044200 02012620 |