On Target NK1R_HUMAN 0/CHEMBL319653
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL319653. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL319653 (Similar Ligand) |
|---|---|
| C | CN1C(=O)C2CN(C3(CCN(CC3)C(=O)c4cc(cc(c4)C(F)(F)F)C(F)(F)F)C2C1=O)S(=O)(=O)c5ccc6ccccc6c5 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030010 038a1c00 01100100 01b10600 00080001 00000010 10000400 22001000 00200000 004009f0 00202010 70039002 0c00881a 01000001 80e00400 08000008 00006004 02000000 00402010 00007603 80020000 180e8638 00000000 1850001c 02001000 c000000c 08000000 9000000c 00000502 20060213 a0140000 00812270 |