On Target NPY4R_HUMAN 0/CHEMBL2371910
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL2371910. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL2371910 (Similar Ligand) |
|---|---|
| C | CCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](Cc1c[nH]c2ccccc12)NC(=O)[C@@H](N)CCC[C@H](N)C(=O)N[C@@H](Cc3c[nH]c4ccccc34)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCC)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc5ccc(O)cc5)C(=O)N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](Cc6ccc(O)cc6)C(=O)N |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010002 01003a08 20100100 45810e10 00041202 00000000 02012000 2000000c 00600880 000908c2 08300014 4003b000 1e00881a 00402809 80000040 0004000c 00000800 02000000 00202408 00020201 40000100 38248638 20800003 93500018 00043800 80000000 48130000 10000000 0c000000 0006000b 20064200 00002620 |