On Target CNR1_HUMAN 0/CHEMBL1223592
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL1223592. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL1223592 (Similar Ligand) |
|---|---|
| C | CCCCC1=NN(CC1c2ccsc2)C(=O)NC(C)(C)c3ccccc3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0089000c 01801000 00180902 a3011e00 00502000 00000000 00008005 03007006 00000800 000868c1 09311258 40218084 00009808 00201009 00001082 00200010 0000c008 02001000 80002440 00204801 80080108 58a58490 40001000 11500098 00214000 84400082 40008000 90000004 04000102 008f0003 000f8800 80c10f00 |