On Target PTAFR_HUMAN 0/CHEMBL407427
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL407427. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL407427 (Similar Ligand) |
|---|---|
| C | CCCOc1c(OCCCn2ccnc2)cc(cc1S(=O)(=O)CC(=O)C)[C@@H]3CC[C@H](O3)c4cc(OC)c(OC)c(OC)c4 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 14000003 4f900208 200ea10a 00b10601 00091772 42054000 42040000 00040000 02820908 008848c8 0858a008 60018040 0081d002 31a50080 83280285 020ca00c 05200201 02040204 00c82000 00022a01 88000120 18000220 21800020 08444019 0000a401 80042000 005a8210 00000040 00000202 0046000a 50080000 03010464 |