On Target CLTR1_HUMAN 0/CHEMBL288943
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL288943. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL288943 (Similar Ligand) |
|---|---|
| C | CCCCC\C=C/C\C=C/C=C/C=C/[C@@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](O)CCCC(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010402 43044000 20120000 00100440 41080080 00000001 00000000 00000402 04208000 00144040 00201200 40063000 0603802a 02840001 80190404 0008000c 14800000 00000000 00402080 00620201 40002001 30000e00 03008300 0220081a 00218200 00000010 00404000 80000010 08000000 40140121 24824000 07010200 |