On Target DRD3_HUMAN 0/CHEMBL51536
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL51536. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL51536 (Similar Ligand) |
|---|---|
| C | Cc1ccc(cc1)C(=O)NCN2CCN(CC2)c3ccccc3Cl |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000c002 01000800 00000120 44010e00 00000000 00000000 00000004 0a003000 00000100 00020a40 01200004 40008800 8200a806 00002000 00000040 00000000 00044010 12000000 08000040 00000001 40100100 28038700 20000020 02410016 00002000 80000400 00000000 80000080 08008100 00060001 80040000 80020200 |