On Target ADA2C_HUMAN 0/CHEMBL222928
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL222928. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL222928 (Similar Ligand) |
|---|---|
| C | CC(Oc1ccccc1c2cccc(c2)[N+](=O)[O-])C3=NCCN3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04002002 00000018 20300108 00012602 00001080 00010000 12000008 00002000 15010000 20000863 14210014 60008000 00910002 00000008 21101141 00182018 10020800 22128000 04000020 00020200 40220000 b80c0000 32000001 02404c10 00040080 c0080000 50000200 00002049 08444310 10068000 00000200 04000200 |