On Target GRM1_HUMAN 0/CHEMBL224673
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL224673. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL224673 (Similar Ligand) |
|---|---|
| C | CCc1ccc(cc1)N2C(=Nc3c(sc4nccc(N(C)C)c34)C2=O)C |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030012 31800a00 00004118 50094600 001c0060 0000c860 00089802 10009008 36500100 400818e0 09204a0c d0038080 80109830 00e00200 080620c0 020c0c0c 28040008 22008090 08600010 00c10000 40000080 588c80f8 218000c1 83700010 00004001 cc000048 60008080 00040084 0400c804 0046100a 40058000 40c10ec0 |