On Target AGTR2_HUMAN 0/CHEMBL415073
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL415073. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL415073 (Similar Ligand) |
|---|---|
| C | CCCCOC(=O)NS(=O)(=O)c1ccccc1c2ccc(CN3C(=Nc4ccc(NC(=O)N(C)C(C)C)cc4C3=O)CCCC)c(F)c2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 0000201e 01c00201 01101100 16b10f00 000c0020 00004030 01001804 80803101 86100108 500028e0 0128a00d 70818000 800b9808 02f11101 883300c0 021c000c 02062280 0640c008 0c680008 10016005 c0000100 18018c38 31a2a041 89780418 0010a004 c0000082 a0080000 000400cf 0400c604 20c6804b 402c5000 600142e0 |