On Target NPY5R_HUMAN 0/CHEMBL350620
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL350620. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL350620 (Similar Ligand) |
|---|---|
| C | COc1ccc2CCCC(CNCC3CCN(CCNS(=O)(=O)c4cccc5ccccc45)CC3)Cc2c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000090 43800208 2110010a 01b10600 00081000 40000002 02060000 20000001 00200800 000808c0 08302000 70038000 00000002 20200001 81200021 02048008 01002000 02000000 00682000 00026201 80000100 38000018 00004001 2a500038 02000000 80000005 00120000 1000000c 08000602 2006000a 00020002 00012660 |