On Target CXCR1_HUMAN 0/CHEMBL252911
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL252911. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL252911 (Similar Ligand) |
|---|---|
| C | CN(C)C(=O)c1cccc(Nc2n[s+]([O-])nc2N[C@@H](c3occc3)C4(C)CC4)c1O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 104a0082 01280809 a0980102 00632e00 06402000 48022009 02000220 02313401 00804900 002808d4 01300024 c0409800 44089c0a 09210008 10020060 30406048 00044401 22008000 0a048300 24020001 48280500 18138600 20250000 01490034 80940030 80000200 24302010 9c8c41c0 2040c102 a0060003 8c0c1820 e0016650 |