On Target DRD1_HUMAN 0/CHEMBL213444
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL213444. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL213444 (Similar Ligand) |
|---|---|
| C | CN1CCN(CC1)C2=Nc3cc(Cl)ccc3N(NC(=O)c4cnc5ccccc5c4)c6ccccc26 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00008246 08848800 00184104 0c010610 03041001 80100000 18004030 02001040 00c06d00 0009c843 11300004 44008c30 02008806 c040a009 240604c2 183c00dc 04050808 33004006 0d200006 30a00000 c0000000 2c06b708 63800820 8260000c 000c2000 d8000100 4e080400 b1031c80 0848a118 00ee0002 c0040001 c6020380 |