On Target OPRX_HUMAN 0/CHEMBL238600
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL238600. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL238600 (Similar Ligand) |
|---|---|
| C | COc1ccc(C)c(OC(CCN2CCC(CC2)N3C(=O)N(CC(=O)NCc4ccccc4)c5ccccc35)C(C)C)c1 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 04000003 01800c08 20100108 40010700 001c1040 02006080 42040000 22001000 04200101 800109e0 0d20900c 5001a000 00809802 01c40000 01300cc1 0c0c300c 00b00000 62008004 00e00000 00020a01 c0000000 38008630 21800081 0270001e 1c000001 c0000000 00020000 90000000 08010300 00460011 400c0000 00002ac0 |