On Target GRM8_HUMAN 0/CHEMBL229697
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL229697. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL229697 (Similar Ligand) |
|---|---|
| C | N[C@]1(C[C@H]1CP(=O)(O)O)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00010000 01000200 00000000 00000400 00080000 00000000 00000000 00000000 00000000 00040080 00000000 40003000 04008070 07070000 06000000 10080008 00000038 00300000 0041c400 00000001 00000000 15100a00 03400000 00000010 00000000 00000000 00000000 00014000 00040000 00040000 10000000 00008001 |