On Target 5HT6R_HUMAN 0/CHEMBL247673
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL247673. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL247673 (Similar Ligand) |
|---|---|
| C | CN(C)CCc1cn(c2ccccc12)S(=O)(=O)c3ccc(cc3)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000012 00801800 21142100 41b10650 00061008 00000010 40003400 00000000 00400000 00090850 08202004 70008000 10001802 01440001 84200041 00040004 00000040 02000100 00600400 00022000 c0000000 18208008 a0800050 9940001a 00842008 80000000 28000000 90000028 04004400 20060022 00140200 00010620 |