On Target 5HT4R_HUMAN 0/CHEMBL121913
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL121913. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL121913 (Similar Ligand) |
|---|---|
| C | COc1cc(N)c(Cl)cc1C(=O)OCCN2CCN(CC2)c3ncccn3 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00008002 90000808 20000308 84090600 00001090 00024000 06002000 00000800 00000100 20000840 00201004 40008800 02008006 08012000 81101049 021c200c 10060800 02004400 00400000 00a20400 40000000 2e020b20 32800860 02400004 00002400 80002400 00180800 00000001 08808318 00460800 c0005000 00020280 |