On Target CCR2_HUMAN 0/CHEMBL226017
For the given ligand Methane, we have found in our database that, being scored 0, the most similar ligand is CHEMBL226017. Check out the elaboration below.
| Methane (Given Ligand) | CHEMBL226017 (Similar Ligand) |
|---|---|
| C | FC(F)(F)c1cc(CNC(=O)[C@H]2CC[C@H](C2)N3CCC4(CC3)C=Cc5ccccc45)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00030000 018a0200 00100301 00010600 20000001 00802000 90000481 22001400 10200800 00b808d0 08300000 50039002 0402881a 01200000 00000402 02040008 00004400 02100000 00002000 00000a01 80100100 18008630 0000c020 00500018 01000000 c0000001 08402000 d0000000 04400100 0106000b 24140000 00802600 |