On Target PR_HIV1 0.33984375/CHEMBL492666
For the given ligand Danoprevir, we have found in our database that, being scored 0.33984375, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Danoprevir (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| CC(C)(C)OC(=O)N[C@@H]6CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]5C[C@@H](OC(=O)N4Cc3cccc(F)c3C4)CN5C6=O | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 00050280 0dc07800 00100300 97310700 00100080 00018010 000a0001 a200140a 10800200 0050a8c8 00202400 5101b000 0e02c81a 01243303 805814a0 081a8008 12266200 02080140 40e12810 02004201 80020000 bc148e70 13008083 3254003c 02200001 c0281003 00c04200 9020002d 0c000300 81068487 a4064000 01012a70 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |