On Target NS5B_HCV1A 0.5947136/CHEMBL3644875
For the given ligand Danoprevir, we have found in our database that, being scored 0.5947136, the most similar ligand is CHEMBL3644875. Check out the elaboration below.
| Danoprevir (Given Ligand) | CHEMBL3644875 (Similar Ligand) |
|---|---|
| CC(C)(C)OC(=O)N[C@@H]6CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]5C[C@@H](OC(=O)N4Cc3cccc(F)c3C4)CN5C6=O | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1CN(Cc2ccccc2)CN1C(=O)[C@@H](NC(=O)OC1CCCC1)C(C)(C)C)C(=O)NS(=O)(=O)C1CC1 |
|
|
|
|
|
|
| 00050280 0dc07800 00100300 97310700 00100080 00018010 000a0001 a200140a 10800200 0050a8c8 00202400 5101b000 0e02c81a 01243303 805814a0 081a8008 12266200 02080140 40e12810 02004201 80020000 bc148e70 13008083 3254003c 02200001 c0281003 00c04200 9020002d 0c000300 81068487 a4064000 01012a70 | 00010080 0d403400 00100100 05310f00 00080000 00018000 000a0004 a2003408 10800200 005389e8 01202400 4001b000 0e00f802 01042101 80400400 001a8008 02824010 02082000 40610850 00004201 00000100 bc058e10 01000003 32440038 02013000 c0001002 00000000 9020002c 08000300 81060093 a41c4000 81012270 |