On Target NA_INFB 0.46341464/CHEMBL254679
For the given ligand Danoprevir, we have found in our database that, being scored 0.46341464, the most similar ligand is CHEMBL254679. Check out the elaboration below.
| Danoprevir (Given Ligand) | CHEMBL254679 (Similar Ligand) |
|---|---|
| CC(C)(C)OC(=O)N[C@@H]6CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]5C[C@@H](OC(=O)N4Cc3cccc(F)c3C4)CN5C6=O | C=C[C@H](OC)[C@H](NC(C)=O)[C@@H]1N[C@@H](C(=O)O)C[C@H]1/C=C\C |
|
|
|
|
|
|
| 00050280 0dc07800 00100300 97310700 00100080 00018010 000a0001 a200140a 10800200 0050a8c8 00202400 5101b000 0e02c81a 01243303 805814a0 081a8008 12266200 02080140 40e12810 02004201 80020000 bc148e70 13008083 3254003c 02200001 c0281003 00c04200 9020002d 0c000300 81068487 a4064000 01012a70 | 00010000 09007000 00100100 04010500 00080080 00000010 00080000 20000408 10000000 00108088 00200000 4001b000 0602801a 01802001 80181400 00080008 10a04000 00000040 40c02010 00000201 00000000 30040e30 13008081 02100018 00000001 00000000 00c04000 90000001 0c000200 00040401 24024000 00002210 |