On Target PLP_SARS 0.41532257/CHEMBL212080
For the given ligand Danoprevir, we have found in our database that, being scored 0.41532257, the most similar ligand is CHEMBL212080. Check out the elaboration below.
| Danoprevir (Given Ligand) | CHEMBL212080 (Similar Ligand) |
|---|---|
| CC(C)(C)OC(=O)N[C@@H]6CCCCC/C=C\[C@@H]1C[C@@]1(C(=O)NS(=O)(=O)C2CC2)NC(=O)[C@@H]5C[C@@H](OC(=O)N4Cc3cccc(F)c3C4)CN5C6=O | CCOC(=O)/C=C/[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)OC(C)(C)C |
|
|
|
|
|
|
| 00050280 0dc07800 00100300 97310700 00100080 00018010 000a0001 a200140a 10800200 0050a8c8 00202400 5101b000 0e02c81a 01243303 805814a0 081a8008 12266200 02080140 40e12810 02004201 80020000 bc148e70 13008083 3254003c 02200001 c0281003 00c04200 9020002d 0c000300 81068487 a4064000 01012a70 | 01030000 0140f000 00100100 84010600 00040080 0023c810 02100080 28000408 01a00300 001088c0 40200000 4003b000 1e028002 00092001 80001408 021a0008 20220000 02080500 20812890 01001201 00002020 38040fb0 13008083 02500018 00001401 8800ac02 00c84800 90200120 08000200 00060001 ec004000 02802210 |