On Target NS3_HCV1A 0.28636363/CHEMBL3645759
For the given ligand Amprenavir, we have found in our database that, being scored 0.28636363, the most similar ligand is CHEMBL3645759. Check out the elaboration below.
| Amprenavir (Given Ligand) | CHEMBL3645759 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | C=C[C@@H]1C[C@]1(NC(=O)[C@@H]1C[C@@]2(CN1C(=O)[C@@H](NC(=O)[C@@H](NC(=O)[C@@H](OC)c1ccccc1)C1CCCCC1)C(C)(C)C)C(C)(C)C21CCC1)C(=O)NS(=O)(=O)N1CCCC1 |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080090 00028000 00000000 20000044 00542a00 014809e0 08302004 60018010 00008002 00200101 80e80040 001a0008 10022000 02080000 01400800 01007603 c0000100 18280c90 27100040 d9500058 02000400 8000100e 00000000 1020006c 04000600 2006001b 80000000 00012670 | 000100a0 09003000 06100100 05210600 00000080 00004010 000a0000 20001408 10000180 0018c9c8 08602000 4001f000 0701801a 01012013 e0581400 02080008 14004000 82000000 46012000 00004201 00000000 38240630 12000003 b3d00038 00000000 80002000 00000000 90000011 0c000200 c0060083 64026004 00012660 |