On Target NS3_HCV1A 0.4473684/CHEMBL296588
For the given ligand 1-deoxymannojirimycin, we have found in our database that, being scored 0.4473684, the most similar ligand is CHEMBL296588. Check out the elaboration below.
| 1-deoxymannojirimycin (Given Ligand) | CHEMBL296588 (Similar Ligand) |
|---|---|
| OC[C@H]1NC[C@@H](O)C(O)[C@H]1O | CC(C)CC(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)N[C@@H](C)C(=O)N[C@@H](CC(C)C)[C@@H](O)CC(=O)O)C(C)C)C(C)C |
|
|
|
|
|
|
| 00000000 01000000 00100000 00000400 00380080 00000000 00000000 20000000 00000000 00000080 00200000 50010000 00000002 02800000 00280000 00080008 10000000 00000000 01c02000 00000201 00000000 10000010 07000080 00000010 00000001 00000000 00000000 10000000 00000000 00040000 00000000 00000a00 | 00030000 01007000 00100000 04000400 00180080 00000000 00000000 20000008 00200000 00000080 00200000 40033000 1600800a 00802001 80180000 00080008 10000000 00000000 01c02000 00000201 00000000 30040e10 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040001 20024000 00802a00 |