On Target NS3_HCV1B 0.23859648/CHEMBL1170417
For the given ligand Etravirine, we have found in our database that, being scored 0.23859648, the most similar ligand is CHEMBL1170417. Check out the elaboration below.
| Etravirine (Given Ligand) | CHEMBL1170417 (Similar Ligand) |
|---|---|
| Cc1cc(C#N)cc(C)c1Oc3nc(Nc2ccc(C#N)cc2)nc(N)c3Br | C=Cc1cc([C@@H](NC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)(C)C)C(=O)N[C@@H](CCC)C(=O)NS(=O)(=O)c2ccccc2C=C)ccc1Oc1cc(-c2ccccc2)nc2cc(OC)ccc12 |
|
|
|
|
|
|
| 0200c402 80008838 2000010a 08090600 82001029 00804000 0a04a400 00000808 80000104 80800850 00200004 41009040 00000106 08008001 81800041 001c200c 00460000 92004008 08e02000 10a66000 414a0200 0c000800 20800c40 00502000 00004000 80000000 00020000 102100c0 00008328 00460c00 40025408 082800c0 | 08012092 41c03008 21104108 15b10600 002c1021 00018008 96060080 22081408 80800284 1049a8c0 08202004 6001b000 0f008802 0040a001 c1720441 025ea00c 020220c0 02082004 04682810 80467e01 c0400000 38248e18 30800003 bb400038 02002000 c0000006 88322048 9020406c 0c404784 20260403 a4067c02 00252670 |