On Target PA_INFA 0.22767857/CHEMBL2040552
For the given ligand Letermovir, we have found in our database that, being scored 0.22767857, the most similar ligand is CHEMBL2040552. Check out the elaboration below.
| Letermovir (Given Ligand) | CHEMBL2040552 (Similar Ligand) |
|---|---|
| COc5cccc(N4CCN(/C2=N/c1c(F)cccc1[C@H](CC(=O)O)N2c3cc(C(F)(F)F)ccc3OC)CC4)c5 | O=C(O)/C(O)=C/C(=O)c1ccc(N2CCNCC2)cc1 |
|
|
|
|
|
|
| 00004046 80000018 60100128 06010e00 a0021000 00100010 02042404 03003001 00000e00 000a2a52 19300004 5401d224 0c00b882 49003008 010200e1 00184098 00054c90 0e400004 09c00058 00022411 50122100 3a01aa00 230302f0 02438012 009d2802 88000001 e0020400 90000881 08508390 0086a022 001c0420 e5024700 | 00004002 00000800 00000120 c4010600 00000000 00800000 00000001 00000400 01000000 00980a40 08200004 4000c000 80008002 0000a000 00000040 00080008 00040400 02100000 08250010 00000800 40100000 38020a80 24008020 02400016 00001000 84004400 00400000 00000080 0800c000 00060002 84000000 00000600 |