On Target PR_HIV1 0.19097222/CHEMBL523528
For the given ligand Letermovir, we have found in our database that, being scored 0.19097222, the most similar ligand is CHEMBL523528. Check out the elaboration below.
| Letermovir (Given Ligand) | CHEMBL523528 (Similar Ligand) |
|---|---|
| COc5cccc(N4CCN(/C2=N/c1c(F)cccc1[C@H](CC(=O)O)N2c3cc(C(F)(F)F)ccc3OC)CC4)c5 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCOC2)cc1 |
|
|
|
|
|
|
| 00004046 80000018 60100128 06010e00 a0021000 00100010 02042404 03003001 00000e00 000a2a52 19300004 5401d224 0c00b882 49003008 010200e1 00184098 00054c90 0e400004 09c00058 00022411 50122100 3a01aa00 230302f0 02438012 009d2802 88000001 e0020400 90000881 08508390 0086a022 001c0420 e5024700 | 00000010 01c05409 2110050a 01b10600 00081080 00028000 02802800 20000004 00742a00 014809e0 08302000 60018010 00008002 00200001 81e80001 003a0008 10022000 02080000 01400800 01027603 80100100 18280c90 07100040 d9500058 02000000 8000000e 00800000 342000cc 04000600 20060013 80000000 00012670 |