On Target PR_HIV1 0.85897434/CHEMBL510485
For the given ligand Amprenavir, we have found in our database that, being scored 0.85897434, the most similar ligand is CHEMBL510485. Check out the elaboration below.
| Amprenavir (Given Ligand) | CHEMBL510485 (Similar Ligand) |
|---|---|
| CC(C)CN(C[C@@H](O)[C@H](Cc1ccccc1)NC(=O)O[C@H]2CCOC2)S(=O)(=O)c3ccc(N)cc3 | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2COCCOCCOCCOC2)cc1 |
|
|
|
|
|
|
| 00000012 01c07401 0110050a 01b10600 00080090 00028000 00000000 20000044 00542a00 014809e0 08302004 60018010 00008002 00200101 80e80040 001a0008 10022000 02080000 01400800 01007603 c0000100 18280c90 27100040 d9500058 02000400 8000100e 00000000 1020006c 04000600 2006001b 80000000 00012670 | 00000010 01c05409 2110050a 01b10600 000810c0 00028000 02000000 20000044 00542a00 014809e0 08302000 60018010 00008002 00200001 81e80001 001a8008 10022000 02080000 01400800 01027603 80000120 18280c90 07100040 d9500058 02000400 8000000e 00800000 102000ec 04000600 20060013 80000000 00012670 |