On Target PR_HIV1 0.19565217/CHEMBL492666
For the given ligand Etravirine, we have found in our database that, being scored 0.19565217, the most similar ligand is CHEMBL492666. Check out the elaboration below.
| Etravirine (Given Ligand) | CHEMBL492666 (Similar Ligand) |
|---|---|
| Cc1cc(C#N)cc(C)c1Oc3nc(Nc2ccc(C#N)cc2)nc(N)c3Br | COc1ccc(S(=O)(=O)N(CC(C)C)C[C@@H](O)[C@H](Cc2ccccc2)NC(=O)OC2CCCCCC2)cc1 |
|
|
|
|
|
|
| 0200c402 80008838 2000010a 08090600 82001029 00804000 0a04a400 00000808 80000104 80800850 00200004 41009040 00000106 08008001 81800041 001c200c 00460000 92004008 08e02000 10a66000 414a0200 0c000800 20800c40 00502000 00004000 80000000 00020000 102100c0 00008328 00460c00 40025408 082800c0 | 00000010 01c05408 2110010a 01b10700 00081080 00028000 02000000 a0000004 00540a00 004809e0 08302000 60018000 00008002 00a00101 81e80001 001a0008 10822000 02080000 00402800 01027603 80000100 18280c90 03100040 d9500058 02000000 8000100e 00800000 1020108c 04000600 20060013 80020000 00012670 |